C28H42O3Si2 — CID 177480214
tert-butyl-diphenyl-[(2S)-2-[(2R,3S)-3-[(1R)-1-trimethylsilyloxybut-3-enyl]oxiran-2-yl]propoxy]silane (PubChem CID 177480214) has the molecular formula C28H42O3Si2 and a molecular weight of 482.81 g/mol. Its IUPAC name is tert-butyl-diphenyl-[(2S)-2-[(2R,3S)-3-[(1R)-1-trimethylsilyloxybut-3-enyl]oxiran-2-yl]propoxy]silane.
| Compound Name | tert-butyl-diphenyl-[(2S)-2-[(2R,3S)-3-[(1R)-1-trimethylsilyloxybut-3-enyl]oxiran-2-yl]propoxy]silane |
|---|---|
| PubChem CID | 177480214 |
| Molecular Formula | C28H42O3Si2 |
| Molecular Weight | 482.81 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | tert-butyl-diphenyl-[(2S)-2-[(2R,3S)-3-[(1R)-1-trimethylsilyloxybut-3-enyl]oxiran-2-yl]propoxy]silane |
| SMILES | C=CC[C@@H](O[Si](C)(C)C)[C@H]1O[C@@H]1[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H42O3Si2/c1-9-16-25(31-32(6,7)8)27-26(30-27)22(2)21-29-33(28(3,4)5,23-17-12-10-13-18-23)24-19-14-11-15-20-24/h9-15,17-20,22,25-27H,1,16,21H2,2-8H3/t22-,25+,26+,27+/m0/s1 |
| InChIKey | MXHPZEXPJKHOHD-KVVRFYPFSA-N |
| XLogP | 5.76 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.81 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|