C25H32O4Si — CID 10598435
(4R,5R)-4-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-5-methyl-6-methylidene-1,3-dioxan-2-one (PubChem CID 10598435) has the molecular formula C25H32O4Si and a molecular weight of 424.61 g/mol. Its IUPAC name is (4R,5R)-4-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-5-methyl-6-methylidene-1,3-dioxan-2-one.
| Compound Name | (4R,5R)-4-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-5-methyl-6-methylidene-1,3-dioxan-2-one |
|---|---|
| PubChem CID | 10598435 |
| Molecular Formula | C25H32O4Si |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | (4R,5R)-4-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-5-methyl-6-methylidene-1,3-dioxan-2-one |
| SMILES | C=C1OC(=O)O[C@H]([C@H](C)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H]1C |
| InChI | InChI=1S/C25H32O4Si/c1-18(23-19(2)20(3)28-24(26)29-23)17-27-30(25(4,5)6,21-13-9-7-10-14-21)22-15-11-8-12-16-22/h7-16,18-19,23H,3,17H2,1-2,4-6H3/t18-,19+,23-/m1/s1 |
| InChIKey | VHKFMOKJPITFKW-SELNLUPBSA-N |
| XLogP | 4.88 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|