C34H42O4Si — CID 24905946
(2S,3Z,5S,6R)-2-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-5-methyl-6-phenylmethoxy-2,5,6,7-tetrahydrooxocin-8-one (PubChem CID 24905946) has the molecular formula C34H42O4Si and a molecular weight of 542.79 g/mol. Its IUPAC name is (2S,3Z,5S,6R)-2-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-5-methyl-6-phenylmethoxy-2,5,6,7-tetrahydrooxocin-8-one.
| Compound Name | (2S,3Z,5S,6R)-2-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-5-methyl-6-phenylmethoxy-2,5,6,7-tetrahydrooxocin-8-one |
|---|---|
| PubChem CID | 24905946 |
| Molecular Formula | C34H42O4Si |
| Molecular Weight | 542.79 g/mol |
| Exact Mass | 542.29 |
| IUPAC Name | (2S,3Z,5S,6R)-2-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-5-methyl-6-phenylmethoxy-2,5,6,7-tetrahydrooxocin-8-one |
| SMILES | C[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H]1/C=C\[C@H](C)[C@H](OCc2ccccc2)CC(=O)O1 |
| InChI | InChI=1S/C34H42O4Si/c1-26-21-22-31(38-33(35)23-32(26)36-25-28-15-9-6-10-16-28)27(2)24-37-39(34(3,4)5,29-17-11-7-12-18-29)30-19-13-8-14-20-30/h6-22,26-27,31-32H,23-25H2,1-5H3/b22-21-/t26-,27+,31-,32+/m0/s1 |
| InChIKey | NTGWJDJZUIBXGI-JFERZWLWSA-N |
| XLogP | 6.29 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.79 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|