C26H34O3Si — CID 135015590
(2R,5S)-2-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-3,5-dimethyl-2,5-dihydropyran-6-one (PubChem CID 135015590) has the molecular formula C26H34O3Si and a molecular weight of 422.64 g/mol. Its IUPAC name is (2R,5S)-2-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-3,5-dimethyl-2,5-dihydropyran-6-one.
| Compound Name | (2R,5S)-2-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-3,5-dimethyl-2,5-dihydropyran-6-one |
|---|---|
| PubChem CID | 135015590 |
| Molecular Formula | C26H34O3Si |
| Molecular Weight | 422.64 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | (2R,5S)-2-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-3,5-dimethyl-2,5-dihydropyran-6-one |
| SMILES | CC1=C[C@H](C)C(=O)O[C@@H]1[C@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H34O3Si/c1-19-17-20(2)25(27)29-24(19)21(3)18-28-30(26(4,5)6,22-13-9-7-10-14-22)23-15-11-8-12-16-23/h7-17,20-21,24H,18H2,1-6H3/t20-,21+,24-/m0/s1 |
| InChIKey | UARONTYHKOPKSD-IMSXRSKXSA-N |
| XLogP | 4.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.64 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|