C20H28O4SSi — CID 140814430
[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl] methanesulfonate (PubChem CID 140814430) has the molecular formula C20H28O4SSi and a molecular weight of 392.59 g/mol. Its IUPAC name is [(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl] methanesulfonate.
| Compound Name | [(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 140814430 |
| Molecular Formula | C20H28O4SSi |
| Molecular Weight | 392.59 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | [(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl] methanesulfonate |
| SMILES | C[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OS(C)(=O)=O |
| InChI | InChI=1S/C20H28O4SSi/c1-17(24-25(5,21)22)16-23-26(20(2,3)4,18-12-8-6-9-13-18)19-14-10-7-11-15-19/h6-15,17H,16H2,1-5H3/t17-/m1/s1 |
| InChIKey | MXMXSIJCRRVCCX-QGZVFWFLSA-N |
| XLogP | 2.93 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.59 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|