C24H35ClO4SSi — CID 102001891
[(2S,3R)-1-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylpentan-3-yl] chloromethanesulfonate (PubChem CID 102001891) has the molecular formula C24H35ClO4SSi and a molecular weight of 483.15 g/mol. Its IUPAC name is [(2S,3R)-1-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylpentan-3-yl] chloromethanesulfonate.
| Compound Name | [(2S,3R)-1-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylpentan-3-yl] chloromethanesulfonate |
|---|---|
| PubChem CID | 102001891 |
| Molecular Formula | C24H35ClO4SSi |
| Molecular Weight | 483.15 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | [(2S,3R)-1-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylpentan-3-yl] chloromethanesulfonate |
| SMILES | CC(C)[C@@H](OS(=O)(=O)CCl)[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C24H35ClO4SSi/c1-19(2)23(29-30(26,27)18-25)20(3)17-28-31(24(4,5)6,21-13-9-7-10-14-21)22-15-11-8-12-16-22/h7-16,19-20,23H,17-18H2,1-6H3/t20-,23+/m0/s1 |
| InChIKey | CSCJALCCODQWBR-NZQKXSOJSA-N |
| XLogP | 4.77 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.15 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|