C40H48F6O8S2Si2 — CID 23254753
[(2S,5S)-1,6-bis[[tert-butyl(diphenyl)silyl]oxy]-5-(trifluoromethylsulfonyloxy)hexan-2-yl] trifluoromethanesulfonate (PubChem CID 23254753) has the molecular formula C40H48F6O8S2Si2 and a molecular weight of 891.11 g/mol. Its IUPAC name is [(2S,5S)-1,6-bis[[tert-butyl(diphenyl)silyl]oxy]-5-(trifluoromethylsulfonyloxy)hexan-2-yl] trifluoromethanesulfonate.
| Compound Name | [(2S,5S)-1,6-bis[[tert-butyl(diphenyl)silyl]oxy]-5-(trifluoromethylsulfonyloxy)hexan-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 23254753 |
| Molecular Formula | C40H48F6O8S2Si2 |
| Molecular Weight | 891.11 g/mol |
| Exact Mass | 890.22 |
| IUPAC Name | [(2S,5S)-1,6-bis[[tert-butyl(diphenyl)silyl]oxy]-5-(trifluoromethylsulfonyloxy)hexan-2-yl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)[Si](OC[C@H](CC[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OS(=O)(=O)C(F)(F)F)OS(=O)(=O)C(F)(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H48F6O8S2Si2/c1-37(2,3)57(33-19-11-7-12-20-33,34-21-13-8-14-22-34)51-29-31(53-55(47,48)39(41,42)43)27-28-32(54-56(49,50)40(44,45)46)30-52-58(38(4,5)6,35-23-15-9-16-24-35)36-25-17-10-18-26-36/h7-26,31-32H,27-30H2,1-6H3/t31-,32-/m0/s1 |
| InChIKey | XFQFRZDCZVWIEI-ACHIHNKUSA-N |
| XLogP | 7.39 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.11 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|