C21H26O4SSi — CID 141229051
4-[tert-butyl(diphenyl)silyl]oxybut-2-ynyl methanesulfonate (PubChem CID 141229051) has the molecular formula C21H26O4SSi and a molecular weight of 402.59 g/mol. Its IUPAC name is 4-[tert-butyl(diphenyl)silyl]oxybut-2-ynyl methanesulfonate.
| Compound Name | 4-[tert-butyl(diphenyl)silyl]oxybut-2-ynyl methanesulfonate |
|---|---|
| PubChem CID | 141229051 |
| Molecular Formula | C21H26O4SSi |
| Molecular Weight | 402.59 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 4-[tert-butyl(diphenyl)silyl]oxybut-2-ynyl methanesulfonate |
| SMILES | CC(C)(C)[Si](OCC#CCOS(C)(=O)=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H26O4SSi/c1-21(2,3)27(19-13-7-5-8-14-19,20-15-9-6-10-16-20)25-18-12-11-17-24-26(4,22)23/h5-10,13-16H,17-18H2,1-4H3 |
| InChIKey | OHNPDGODTQQSBS-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.59 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|