C28H28O2Si — CID 10387661
(E)-6-[tert-butyl(diphenyl)silyl]oxy-1-phenylhex-1-en-4-yn-3-one (PubChem CID 10387661) has the molecular formula C28H28O2Si and a molecular weight of 424.62 g/mol. Its IUPAC name is (E)-6-[tert-butyl(diphenyl)silyl]oxy-1-phenylhex-1-en-4-yn-3-one.
| Compound Name | (E)-6-[tert-butyl(diphenyl)silyl]oxy-1-phenylhex-1-en-4-yn-3-one |
|---|---|
| PubChem CID | 10387661 |
| Molecular Formula | C28H28O2Si |
| Molecular Weight | 424.62 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | (E)-6-[tert-butyl(diphenyl)silyl]oxy-1-phenylhex-1-en-4-yn-3-one |
| SMILES | CC(C)(C)[Si](OCC#CC(=O)/C=C/c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H28O2Si/c1-28(2,3)31(26-17-9-5-10-18-26,27-19-11-6-12-20-27)30-23-13-16-25(29)22-21-24-14-7-4-8-15-24/h4-12,14-15,17-22H,23H2,1-3H3/b22-21+ |
| InChIKey | MWVBPXJIAWCUGZ-QURGRASLSA-N |
| XLogP | 4.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.62 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|