C32H41NO3SSi — CID 132537284
N-[(E,2R)-1-[tert-butyl(diphenyl)silyl]oxy-4-oxo-6-phenylhex-5-en-2-yl]-2-methylpropane-2-sulfinamide (PubChem CID 132537284) has the molecular formula C32H41NO3SSi and a molecular weight of 547.84 g/mol. Its IUPAC name is N-[(E,2R)-1-[tert-butyl(diphenyl)silyl]oxy-4-oxo-6-phenylhex-5-en-2-yl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[(E,2R)-1-[tert-butyl(diphenyl)silyl]oxy-4-oxo-6-phenylhex-5-en-2-yl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 132537284 |
| Molecular Formula | C32H41NO3SSi |
| Molecular Weight | 547.84 g/mol |
| Exact Mass | 547.26 |
| IUPAC Name | N-[(E,2R)-1-[tert-butyl(diphenyl)silyl]oxy-4-oxo-6-phenylhex-5-en-2-yl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)N[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)CC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C32H41NO3SSi/c1-31(2,3)37(35)33-27(24-28(34)23-22-26-16-10-7-11-17-26)25-36-38(32(4,5)6,29-18-12-8-13-19-29)30-20-14-9-15-21-30/h7-23,27,33H,24-25H2,1-6H3/b23-22+/t27-,37?/m1/s1 |
| InChIKey | XPXGDJHJIKIIFV-PBSGEEECSA-N |
| XLogP | 5.66 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.84 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|