C20H24O3Si — CID 67253789
2-[[tert-butyl(diphenyl)silyl]oxymethyl]prop-2-enoic acid (PubChem CID 67253789) has the molecular formula C20H24O3Si and a molecular weight of 340.50 g/mol. Its IUPAC name is 2-[[tert-butyl(diphenyl)silyl]oxymethyl]prop-2-enoic acid.
| Compound Name | 2-[[tert-butyl(diphenyl)silyl]oxymethyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 67253789 |
| Molecular Formula | C20H24O3Si |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 2-[[tert-butyl(diphenyl)silyl]oxymethyl]prop-2-enoic acid |
| SMILES | C=C(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C20H24O3Si/c1-16(19(21)22)15-23-24(20(2,3)4,17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14H,1,15H2,2-4H3,(H,21,22) |
| InChIKey | KBPLVIBGVRKWLG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|