C23H33NO5Si — CID 174053128
2-[2-[2-[tert-butyl(diphenyl)silyl]oxyethoxy]ethoxy]ethylcarbamic acid (PubChem CID 174053128) has the molecular formula C23H33NO5Si and a molecular weight of 431.61 g/mol. Its IUPAC name is 2-[2-[2-[tert-butyl(diphenyl)silyl]oxyethoxy]ethoxy]ethylcarbamic acid.
| Compound Name | 2-[2-[2-[tert-butyl(diphenyl)silyl]oxyethoxy]ethoxy]ethylcarbamic acid |
|---|---|
| PubChem CID | 174053128 |
| Molecular Formula | C23H33NO5Si |
| Molecular Weight | 431.61 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | 2-[2-[2-[tert-butyl(diphenyl)silyl]oxyethoxy]ethoxy]ethylcarbamic acid |
| SMILES | CC(C)(C)[Si](OCCOCCOCCNC(=O)O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H33NO5Si/c1-23(2,3)30(20-10-6-4-7-11-20,21-12-8-5-9-13-21)29-19-18-28-17-16-27-15-14-24-22(25)26/h4-13,24H,14-19H2,1-3H3,(H,25,26) |
| InChIKey | CEUAQTFCTRRFBJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.61 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|