C29H40BrNO6Si — CID 72527262
2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethyl 2-bromo-4-[tert-butyl(diphenyl)silyl]oxybut-2-enoate (PubChem CID 72527262) has the molecular formula C29H40BrNO6Si and a molecular weight of 606.63 g/mol. Its IUPAC name is 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethyl 2-bromo-4-[tert-butyl(diphenyl)silyl]oxybut-2-enoate.
| Compound Name | 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethyl 2-bromo-4-[tert-butyl(diphenyl)silyl]oxybut-2-enoate |
|---|---|
| PubChem CID | 72527262 |
| Molecular Formula | C29H40BrNO6Si |
| Molecular Weight | 606.63 g/mol |
| Exact Mass | 605.18 |
| IUPAC Name | 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethyl 2-bromo-4-[tert-butyl(diphenyl)silyl]oxybut-2-enoate |
| SMILES | CC(C)(C)OC(=O)NCCOCCOC(=O)C(Br)=CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H40BrNO6Si/c1-28(2,3)37-27(33)31-18-20-34-21-22-35-26(32)25(30)17-19-36-38(29(4,5)6,23-13-9-7-10-14-23)24-15-11-8-12-16-24/h7-17H,18-22H2,1-6H3,(H,31,33) |
| InChIKey | UYWSDENTMRJGTR-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.63 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|