C22H28F2O3Si — CID 140759715
ethyl 4-[tert-butyl(diphenyl)silyl]oxy-2,2-difluorobutanoate (PubChem CID 140759715) has the molecular formula C22H28F2O3Si and a molecular weight of 406.55 g/mol. Its IUPAC name is ethyl 4-[tert-butyl(diphenyl)silyl]oxy-2,2-difluorobutanoate.
| Compound Name | ethyl 4-[tert-butyl(diphenyl)silyl]oxy-2,2-difluorobutanoate |
|---|---|
| PubChem CID | 140759715 |
| Molecular Formula | C22H28F2O3Si |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | ethyl 4-[tert-butyl(diphenyl)silyl]oxy-2,2-difluorobutanoate |
| SMILES | CCOC(=O)C(F)(F)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C22H28F2O3Si/c1-5-26-20(25)22(23,24)16-17-27-28(21(2,3)4,18-12-8-6-9-13-18)19-14-10-7-11-15-19/h6-15H,5,16-17H2,1-4H3 |
| InChIKey | AZIZGZPGCZNKLA-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|