C25H36O3Si — CID 162445089
ethyl 5-[tert-butyl(diphenyl)silyl]oxy-4,4-dimethylpentanoate (PubChem CID 162445089) has the molecular formula C25H36O3Si and a molecular weight of 412.65 g/mol. Its IUPAC name is ethyl 5-[tert-butyl(diphenyl)silyl]oxy-4,4-dimethylpentanoate.
| Compound Name | ethyl 5-[tert-butyl(diphenyl)silyl]oxy-4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 162445089 |
| Molecular Formula | C25H36O3Si |
| Molecular Weight | 412.65 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | ethyl 5-[tert-butyl(diphenyl)silyl]oxy-4,4-dimethylpentanoate |
| SMILES | CCOC(=O)CCC(C)(C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H36O3Si/c1-7-27-23(26)18-19-25(5,6)20-28-29(24(2,3)4,21-14-10-8-11-15-21)22-16-12-9-13-17-22/h8-17H,7,18-20H2,1-6H3 |
| InChIKey | PLBVSWBIHJQJMQ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.65 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|