C28H38N2O3SSi — CID 155592823
ethyl 5-[3-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylpropyl]-2-(methylamino)-1,3-thiazole-4-carboxylate (PubChem CID 155592823) has the molecular formula C28H38N2O3SSi and a molecular weight of 510.78 g/mol. Its IUPAC name is ethyl 5-[3-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylpropyl]-2-(methylamino)-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 5-[3-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylpropyl]-2-(methylamino)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 155592823 |
| Molecular Formula | C28H38N2O3SSi |
| Molecular Weight | 510.78 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | ethyl 5-[3-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylpropyl]-2-(methylamino)-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(NC)sc1CC(C)(C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H38N2O3SSi/c1-8-32-25(31)24-23(34-26(29-7)30-24)19-28(5,6)20-33-35(27(2,3)4,21-15-11-9-12-16-21)22-17-13-10-14-18-22/h9-18H,8,19-20H2,1-7H3,(H,29,30) |
| InChIKey | WNJHAXDCZWATOY-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.78 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|