C27H30O5Si — CID 10766489
3-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-ethoxycarbonylbenzoic acid (PubChem CID 10766489) has the molecular formula C27H30O5Si and a molecular weight of 462.62 g/mol. Its IUPAC name is 3-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-ethoxycarbonylbenzoic acid.
| Compound Name | 3-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-ethoxycarbonylbenzoic acid |
|---|---|
| PubChem CID | 10766489 |
| Molecular Formula | C27H30O5Si |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | 3-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-ethoxycarbonylbenzoic acid |
| SMILES | CCOC(=O)c1cc(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc(C(=O)O)c1 |
| InChI | InChI=1S/C27H30O5Si/c1-5-31-26(30)22-17-20(16-21(18-22)25(28)29)19-32-33(27(2,3)4,23-12-8-6-9-13-23)24-14-10-7-11-15-24/h6-18H,5,19H2,1-4H3,(H,28,29) |
| InChIKey | HUBVROFCGZGAQX-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|