C22H26N2OSi — CID 59295334
4-[[tert-butyl(diphenyl)silyl]oxymethyl]pyridin-2-amine (PubChem CID 59295334) has the molecular formula C22H26N2OSi and a molecular weight of 362.55 g/mol. Its IUPAC name is 4-[[tert-butyl(diphenyl)silyl]oxymethyl]pyridin-2-amine.
| Compound Name | 4-[[tert-butyl(diphenyl)silyl]oxymethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 59295334 |
| Molecular Formula | C22H26N2OSi |
| Molecular Weight | 362.55 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 4-[[tert-butyl(diphenyl)silyl]oxymethyl]pyridin-2-amine |
| SMILES | CC(C)(C)[Si](OCc1ccnc(N)c1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H26N2OSi/c1-22(2,3)26(19-10-6-4-7-11-19,20-12-8-5-9-13-20)25-17-18-14-15-24-21(23)16-18/h4-16H,17H2,1-3H3,(H2,23,24) |
| InChIKey | ABECKLCTIKWZJW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.55 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|