C25H28N2OSi — CID 68704623
tert-butyl-[(2-methylpyrazolo[1,5-a]pyridin-5-yl)methoxy]-diphenylsilane (PubChem CID 68704623) has the molecular formula C25H28N2OSi and a molecular weight of 400.60 g/mol. Its IUPAC name is tert-butyl-[(2-methylpyrazolo[1,5-a]pyridin-5-yl)methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(2-methylpyrazolo[1,5-a]pyridin-5-yl)methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 68704623 |
| Molecular Formula | C25H28N2OSi |
| Molecular Weight | 400.60 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | tert-butyl-[(2-methylpyrazolo[1,5-a]pyridin-5-yl)methoxy]-diphenylsilane |
| SMILES | Cc1cc2cc(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)ccn2n1 |
| InChI | InChI=1S/C25H28N2OSi/c1-20-17-22-18-21(15-16-27(22)26-20)19-28-29(25(2,3)4,23-11-7-5-8-12-23)24-13-9-6-10-14-24/h5-18H,19H2,1-4H3 |
| InChIKey | XIFRMBIKHDYAAG-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.60 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|