C22H25NO2Si — CID 59410156
3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1H-pyridin-2-one (PubChem CID 59410156) has the molecular formula C22H25NO2Si and a molecular weight of 363.53 g/mol. Its IUPAC name is 3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1H-pyridin-2-one.
| Compound Name | 3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 59410156 |
| Molecular Formula | C22H25NO2Si |
| Molecular Weight | 363.53 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1H-pyridin-2-one |
| SMILES | CC(C)(C)[Si](OCc1ccc[nH]c1=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H25NO2Si/c1-22(2,3)26(19-12-6-4-7-13-19,20-14-8-5-9-15-20)25-17-18-11-10-16-23-21(18)24/h4-16H,17H2,1-3H3,(H,23,24) |
| InChIKey | YEKVLCRYGACPJX-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.53 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|