C30H32O2Si — CID 102217007
[2-[[tert-butyl(diphenyl)silyl]oxymethyl]phenyl]-phenylmethanol (PubChem CID 102217007) has the molecular formula C30H32O2Si and a molecular weight of 452.67 g/mol. Its IUPAC name is [2-[[tert-butyl(diphenyl)silyl]oxymethyl]phenyl]-phenylmethanol.
| Compound Name | [2-[[tert-butyl(diphenyl)silyl]oxymethyl]phenyl]-phenylmethanol |
|---|---|
| PubChem CID | 102217007 |
| Molecular Formula | C30H32O2Si |
| Molecular Weight | 452.67 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | [2-[[tert-butyl(diphenyl)silyl]oxymethyl]phenyl]-phenylmethanol |
| SMILES | CC(C)(C)[Si](OCc1ccccc1C(O)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H32O2Si/c1-30(2,3)33(26-18-9-5-10-19-26,27-20-11-6-12-21-27)32-23-25-17-13-14-22-28(25)29(31)24-15-7-4-8-16-24/h4-22,29,31H,23H2,1-3H3 |
| InChIKey | ICDXBQAIXNCDDJ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.67 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|