C40H44O3Si2 — CID 11169578
[tert-butyl(diphenyl)silyl] 2-[[tert-butyl(diphenyl)silyl]oxymethyl]benzoate (PubChem CID 11169578) has the molecular formula C40H44O3Si2 and a molecular weight of 628.96 g/mol. Its IUPAC name is [tert-butyl(diphenyl)silyl] 2-[[tert-butyl(diphenyl)silyl]oxymethyl]benzoate.
| Compound Name | [tert-butyl(diphenyl)silyl] 2-[[tert-butyl(diphenyl)silyl]oxymethyl]benzoate |
|---|---|
| PubChem CID | 11169578 |
| Molecular Formula | C40H44O3Si2 |
| Molecular Weight | 628.96 g/mol |
| Exact Mass | 628.28 |
| IUPAC Name | [tert-butyl(diphenyl)silyl] 2-[[tert-butyl(diphenyl)silyl]oxymethyl]benzoate |
| SMILES | CC(C)(C)[Si](OCc1ccccc1C(=O)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H44O3Si2/c1-39(2,3)44(33-22-11-7-12-23-33,34-24-13-8-14-25-34)42-31-32-21-19-20-30-37(32)38(41)43-45(40(4,5)6,35-26-15-9-16-27-35)36-28-17-10-18-29-36/h7-30H,31H2,1-6H3 |
| InChIKey | TZDVTTFIYGIOFP-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.96 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|