C25H26N2O3Si — CID 70132244
2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1H-benzimidazole-4-carboxylic acid (PubChem CID 70132244) has the molecular formula C25H26N2O3Si and a molecular weight of 430.58 g/mol. Its IUPAC name is 2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1H-benzimidazole-4-carboxylic acid.
| Compound Name | 2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1H-benzimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 70132244 |
| Molecular Formula | C25H26N2O3Si |
| Molecular Weight | 430.58 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1H-benzimidazole-4-carboxylic acid |
| SMILES | CC(C)(C)[Si](OCc1nc2c(C(=O)O)cccc2[nH]1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H26N2O3Si/c1-25(2,3)31(18-11-6-4-7-12-18,19-13-8-5-9-14-19)30-17-22-26-21-16-10-15-20(24(28)29)23(21)27-22/h4-16H,17H2,1-3H3,(H,26,27)(H,28,29) |
| InChIKey | BMUBHWVXTLBMMD-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.58 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|