C37H40N2OSi — CID 166067461
tert-butyl-[2-[4-[4-(cyclohexen-1-yl)phenyl]-1H-benzimidazol-2-yl]ethoxy]-diphenylsilane (PubChem CID 166067461) has the molecular formula C37H40N2OSi and a molecular weight of 556.83 g/mol. Its IUPAC name is tert-butyl-[2-[4-[4-(cyclohexen-1-yl)phenyl]-1H-benzimidazol-2-yl]ethoxy]-diphenylsilane.
| Compound Name | tert-butyl-[2-[4-[4-(cyclohexen-1-yl)phenyl]-1H-benzimidazol-2-yl]ethoxy]-diphenylsilane |
|---|---|
| PubChem CID | 166067461 |
| Molecular Formula | C37H40N2OSi |
| Molecular Weight | 556.83 g/mol |
| Exact Mass | 556.29 |
| IUPAC Name | tert-butyl-[2-[4-[4-(cyclohexen-1-yl)phenyl]-1H-benzimidazol-2-yl]ethoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](OCCc1nc2c(-c3ccc(C4=CCCCC4)cc3)cccc2[nH]1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H40N2OSi/c1-37(2,3)41(31-16-9-5-10-17-31,32-18-11-6-12-19-32)40-27-26-35-38-34-21-13-20-33(36(34)39-35)30-24-22-29(23-25-30)28-14-7-4-8-15-28/h5-6,9-14,16-25H,4,7-8,15,26-27H2,1-3H3,(H,38,39) |
| InChIKey | ZHHHPKSMOSQQBR-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.83 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|