C34H35ClO3Si — CID 11353431
[(Z)-1-chloro-4-phenylbut-1-enyl] 2-[[tert-butyl(diphenyl)silyl]oxymethyl]benzoate (PubChem CID 11353431) has the molecular formula C34H35ClO3Si and a molecular weight of 555.19 g/mol. Its IUPAC name is [(Z)-1-chloro-4-phenylbut-1-enyl] 2-[[tert-butyl(diphenyl)silyl]oxymethyl]benzoate.
| Compound Name | [(Z)-1-chloro-4-phenylbut-1-enyl] 2-[[tert-butyl(diphenyl)silyl]oxymethyl]benzoate |
|---|---|
| PubChem CID | 11353431 |
| Molecular Formula | C34H35ClO3Si |
| Molecular Weight | 555.19 g/mol |
| Exact Mass | 554.20 |
| IUPAC Name | [(Z)-1-chloro-4-phenylbut-1-enyl] 2-[[tert-butyl(diphenyl)silyl]oxymethyl]benzoate |
| SMILES | CC(C)(C)[Si](OCc1ccccc1C(=O)O/C(Cl)=C/CCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H35ClO3Si/c1-34(2,3)39(29-20-9-5-10-21-29,30-22-11-6-12-23-30)37-26-28-19-13-14-24-31(28)33(36)38-32(35)25-15-18-27-16-7-4-8-17-27/h4-14,16-17,19-25H,15,18,26H2,1-3H3/b32-25+ |
| InChIKey | SYVQKPQMNBWKGH-WGPBWIAQSA-N |
| XLogP | 7.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.19 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|