C23H24O3Si — CID 16655856
2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 16655856) has the molecular formula C23H24O3Si and a molecular weight of 376.53 g/mol. Its IUPAC name is 2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 16655856 |
| Molecular Formula | C23H24O3Si |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | CC(C)(C)[Si](OCC1=CC(=O)C=CC1=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H24O3Si/c1-23(2,3)27(20-10-6-4-7-11-20,21-12-8-5-9-13-21)26-17-18-16-19(24)14-15-22(18)25/h4-16H,17H2,1-3H3 |
| InChIKey | DSFUHFVRVVMUOS-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|