C25H29BrO4Si — CID 15543714
2-bromo-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,4-dimethoxycyclohexa-2,5-dien-1-one (PubChem CID 15543714) has the molecular formula C25H29BrO4Si and a molecular weight of 501.49 g/mol. Its IUPAC name is 2-bromo-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,4-dimethoxycyclohexa-2,5-dien-1-one.
| Compound Name | 2-bromo-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,4-dimethoxycyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 15543714 |
| Molecular Formula | C25H29BrO4Si |
| Molecular Weight | 501.49 g/mol |
| Exact Mass | 500.10 |
| IUPAC Name | 2-bromo-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,4-dimethoxycyclohexa-2,5-dien-1-one |
| SMILES | COC1(OC)C=CC(=O)C(Br)=C1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H29BrO4Si/c1-24(2,3)31(19-12-8-6-9-13-19,20-14-10-7-11-15-20)30-18-21-23(26)22(27)16-17-25(21,28-4)29-5/h6-17H,18H2,1-5H3 |
| InChIKey | DPUDCWRGBDTREI-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.49 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|