C29H40O8Si — CID 134831815
(6S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5,6-tris(methoxymethoxy)cyclohex-2-en-1-one (PubChem CID 134831815) has the molecular formula C29H40O8Si and a molecular weight of 544.72 g/mol. Its IUPAC name is (6S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5,6-tris(methoxymethoxy)cyclohex-2-en-1-one.
| Compound Name | (6S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5,6-tris(methoxymethoxy)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 134831815 |
| Molecular Formula | C29H40O8Si |
| Molecular Weight | 544.72 g/mol |
| Exact Mass | 544.25 |
| IUPAC Name | (6S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5,6-tris(methoxymethoxy)cyclohex-2-en-1-one |
| SMILES | COCOC1C(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)=CC(=O)[C@@H](OCOC)C1OCOC |
| InChI | InChI=1S/C29H40O8Si/c1-29(2,3)38(23-13-9-7-10-14-23,24-15-11-8-12-16-24)37-18-22-17-25(30)27(35-20-32-5)28(36-21-33-6)26(22)34-19-31-4/h7-17,26-28H,18-21H2,1-6H3/t26?,27-,28?/m1/s1 |
| InChIKey | IRQYCOYVPJEWFK-QBYNGQAISA-N |
| XLogP | 3.04 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.72 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|