C29H40O7Si — CID 102039676
methyl (1S,5S,6S)-1-[[tert-butyl(diphenyl)silyl]oxymethyl]-5,6-bis(methoxymethoxy)cyclohex-2-ene-1-carboxylate (PubChem CID 102039676) has the molecular formula C29H40O7Si and a molecular weight of 528.72 g/mol. Its IUPAC name is methyl (1S,5S,6S)-1-[[tert-butyl(diphenyl)silyl]oxymethyl]-5,6-bis(methoxymethoxy)cyclohex-2-ene-1-carboxylate.
| Compound Name | methyl (1S,5S,6S)-1-[[tert-butyl(diphenyl)silyl]oxymethyl]-5,6-bis(methoxymethoxy)cyclohex-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 102039676 |
| Molecular Formula | C29H40O7Si |
| Molecular Weight | 528.72 g/mol |
| Exact Mass | 528.25 |
| IUPAC Name | methyl (1S,5S,6S)-1-[[tert-butyl(diphenyl)silyl]oxymethyl]-5,6-bis(methoxymethoxy)cyclohex-2-ene-1-carboxylate |
| SMILES | COCO[C@H]1CC=C[C@@](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)(C(=O)OC)[C@@H]1OCOC |
| InChI | InChI=1S/C29H40O7Si/c1-28(2,3)37(23-14-9-7-10-15-23,24-16-11-8-12-17-24)36-20-29(27(30)33-6)19-13-18-25(34-21-31-4)26(29)35-22-32-5/h7-17,19,25-26H,18,20-22H2,1-6H3/t25-,26+,29-/m0/s1 |
| InChIKey | VELWGABYBQABQO-HFASVGIHSA-N |
| XLogP | 3.66 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.72 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|