C31H40O5Si — CID 101460434
prop-2-enyl (1S,2S,3aR,6aS)-1-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(methoxymethoxy)-3,3a,4,6a-tetrahydro-2H-pentalene-1-carboxylate (PubChem CID 101460434) has the molecular formula C31H40O5Si and a molecular weight of 520.74 g/mol. Its IUPAC name is prop-2-enyl (1S,2S,3aR,6aS)-1-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(methoxymethoxy)-3,3a,4,6a-tetrahydro-2H-pentalene-1-carboxylate.
| Compound Name | prop-2-enyl (1S,2S,3aR,6aS)-1-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(methoxymethoxy)-3,3a,4,6a-tetrahydro-2H-pentalene-1-carboxylate |
|---|---|
| PubChem CID | 101460434 |
| Molecular Formula | C31H40O5Si |
| Molecular Weight | 520.74 g/mol |
| Exact Mass | 520.26 |
| IUPAC Name | prop-2-enyl (1S,2S,3aR,6aS)-1-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(methoxymethoxy)-3,3a,4,6a-tetrahydro-2H-pentalene-1-carboxylate |
| SMILES | C=CCOC(=O)[C@@]1(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](OCOC)C[C@H]2CC=C[C@H]21 |
| InChI | InChI=1S/C31H40O5Si/c1-6-20-34-29(32)31(27-19-13-14-24(27)21-28(31)35-23-33-5)22-36-37(30(2,3)4,25-15-9-7-10-16-25)26-17-11-8-12-18-26/h6-13,15-19,24,27-28H,1,14,20-23H2,2-5H3/t24-,27-,28+,31-/m1/s1 |
| InChIKey | DWWBQAQNNDSKEH-UOCFAWRCSA-N |
| XLogP | 4.86 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.74 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|