C40H70O9Si3 — CID 46702416
tert-butyl-diphenyl-[(2R,3R,5S,6R)-2,4,6-tris(methoxymethoxy)-3,5-bis(triethylsilyloxy)cyclohexyl]oxysilane (PubChem CID 46702416) has the molecular formula C40H70O9Si3 and a molecular weight of 779.25 g/mol. Its IUPAC name is tert-butyl-diphenyl-[(2R,3R,5S,6R)-2,4,6-tris(methoxymethoxy)-3,5-bis(triethylsilyloxy)cyclohexyl]oxysilane.
| Compound Name | tert-butyl-diphenyl-[(2R,3R,5S,6R)-2,4,6-tris(methoxymethoxy)-3,5-bis(triethylsilyloxy)cyclohexyl]oxysilane |
|---|---|
| PubChem CID | 46702416 |
| Molecular Formula | C40H70O9Si3 |
| Molecular Weight | 779.25 g/mol |
| Exact Mass | 778.43 |
| IUPAC Name | tert-butyl-diphenyl-[(2R,3R,5S,6R)-2,4,6-tris(methoxymethoxy)-3,5-bis(triethylsilyloxy)cyclohexyl]oxysilane |
| SMILES | CC[Si](CC)(CC)O[C@@H]1C(OCOC)[C@H](O[Si](CC)(CC)CC)[C@@H](OCOC)C(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H]1OCOC |
| InChI | InChI=1S/C40H70O9Si3/c1-13-50(14-2,15-3)47-37-34(44-29-41-10)38(48-51(16-4,17-5)18-6)36(46-31-43-12)39(35(37)45-30-42-11)49-52(40(7,8)9,32-25-21-19-22-26-32)33-27-23-20-24-28-33/h19-28,34-39H,13-18,29-31H2,1-12H3/t34?,35-,36-,37-,38+,39?/m1/s1 |
| InChIKey | XUNOXYLYUUNNEX-PWXKWVLJSA-N |
| XLogP | 7.69 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.25 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|