C38H64O5Si3 — CID 101235603
methyl 3-[(1S,2S,3R,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,5-bis(triethylsilyloxy)cyclopentyl]propanoate (PubChem CID 101235603) has the molecular formula C38H64O5Si3 and a molecular weight of 685.18 g/mol. Its IUPAC name is methyl 3-[(1S,2S,3R,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,5-bis(triethylsilyloxy)cyclopentyl]propanoate.
| Compound Name | methyl 3-[(1S,2S,3R,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,5-bis(triethylsilyloxy)cyclopentyl]propanoate |
|---|---|
| PubChem CID | 101235603 |
| Molecular Formula | C38H64O5Si3 |
| Molecular Weight | 685.18 g/mol |
| Exact Mass | 684.41 |
| IUPAC Name | methyl 3-[(1S,2S,3R,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,5-bis(triethylsilyloxy)cyclopentyl]propanoate |
| SMILES | CC[Si](CC)(CC)O[C@H]1C[C@@H](O[Si](CC)(CC)CC)[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H]1CCC(=O)OC |
| InChI | InChI=1S/C38H64O5Si3/c1-11-44(12-2,13-3)42-35-29-36(43-45(14-4,15-5)16-6)34(33(35)27-28-37(39)40-10)30-41-46(38(7,8)9,31-23-19-17-20-24-31)32-25-21-18-22-26-32/h17-26,33-36H,11-16,27-30H2,1-10H3/t33-,34+,35-,36+/m0/s1 |
| InChIKey | MISNTKSVSUYNEI-IHUVGRGJSA-N |
| XLogP | 8.93 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.18 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|