C24H32O3Si — CID 101065949
methyl (E)-7-[tert-butyl(diphenyl)silyl]oxyhept-6-enoate (PubChem CID 101065949) has the molecular formula C24H32O3Si and a molecular weight of 396.60 g/mol. Its IUPAC name is methyl (E)-7-[tert-butyl(diphenyl)silyl]oxyhept-6-enoate.
| Compound Name | methyl (E)-7-[tert-butyl(diphenyl)silyl]oxyhept-6-enoate |
|---|---|
| PubChem CID | 101065949 |
| Molecular Formula | C24H32O3Si |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | methyl (E)-7-[tert-butyl(diphenyl)silyl]oxyhept-6-enoate |
| SMILES | COC(=O)CCCC/C=C/O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C24H32O3Si/c1-24(2,3)28(21-15-9-7-10-16-21,22-17-11-8-12-18-22)27-20-14-6-5-13-19-23(25)26-4/h7-12,14-18,20H,5-6,13,19H2,1-4H3/b20-14+ |
| InChIKey | XBZGUPWWBKBRPK-XSFVSMFZSA-N |
| XLogP | 4.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|