C30H40O3Si — CID 67796297
methyl (Z)-7-[(5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopenten-1-yl]hept-5-enoate (PubChem CID 67796297) has the molecular formula C30H40O3Si and a molecular weight of 476.73 g/mol. Its IUPAC name is methyl (Z)-7-[(5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopenten-1-yl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopenten-1-yl]hept-5-enoate |
|---|---|
| PubChem CID | 67796297 |
| Molecular Formula | C30H40O3Si |
| Molecular Weight | 476.73 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | methyl (Z)-7-[(5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopenten-1-yl]hept-5-enoate |
| SMILES | COC(=O)CCC/C=C\CC1=CCC[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H40O3Si/c1-30(2,3)34(27-19-10-7-11-20-27,28-21-12-8-13-22-28)33-24-26-18-15-17-25(26)16-9-5-6-14-23-29(31)32-4/h5,7-13,17,19-22,26H,6,14-16,18,23-24H2,1-4H3/b9-5-/t26-/m1/s1 |
| InChIKey | TVQJIRVMETXUDZ-MMUQKUGYSA-N |
| XLogP | 6.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.73 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|