C37H47FO5Si — CID 14675064
methyl (Z)-7-[(1R,2S,4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(4-fluorophenyl)-4-hydroxy-2-(hydroxymethyl)cyclopentyl]hept-5-enoate (PubChem CID 14675064) has the molecular formula C37H47FO5Si and a molecular weight of 618.86 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,2S,4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(4-fluorophenyl)-4-hydroxy-2-(hydroxymethyl)cyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,2S,4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(4-fluorophenyl)-4-hydroxy-2-(hydroxymethyl)cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 14675064 |
| Molecular Formula | C37H47FO5Si |
| Molecular Weight | 618.86 g/mol |
| Exact Mass | 618.32 |
| IUPAC Name | methyl (Z)-7-[(1R,2S,4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(4-fluorophenyl)-4-hydroxy-2-(hydroxymethyl)cyclopentyl]hept-5-enoate |
| SMILES | COC(=O)CCC/C=C\C[C@@H]1[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H](O)C[C@@]1(CO)c1ccc(F)cc1 |
| InChI | InChI=1S/C37H47FO5Si/c1-36(2,3)44(30-15-9-7-10-16-30,31-17-11-8-12-18-31)43-26-32-33(19-13-5-6-14-20-35(41)42-4)37(27-39,25-34(32)40)28-21-23-29(38)24-22-28/h5,7-13,15-18,21-24,32-34,39-40H,6,14,19-20,25-27H2,1-4H3/b13-5-/t32-,33-,34-,37-/m1/s1 |
| InChIKey | OGKYKMWYEOWLIB-BACYEOLFSA-N |
| XLogP | 5.92 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.86 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|