C37H46O4Si — CID 14674925
methyl (Z)-7-[(1R,4S,5R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-phenyl-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoate (PubChem CID 14674925) has the molecular formula C37H46O4Si and a molecular weight of 582.86 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,4S,5R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-phenyl-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,4S,5R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-phenyl-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoate |
|---|---|
| PubChem CID | 14674925 |
| Molecular Formula | C37H46O4Si |
| Molecular Weight | 582.86 g/mol |
| Exact Mass | 582.32 |
| IUPAC Name | methyl (Z)-7-[(1R,4S,5R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-phenyl-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoate |
| SMILES | COC(=O)CCC/C=C\C[C@@H]1[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H]2C[C@]1(c1ccccc1)CO2 |
| InChI | InChI=1S/C37H46O4Si/c1-36(2,3)42(30-20-12-8-13-21-30,31-22-14-9-15-23-31)41-27-32-33(24-16-5-6-17-25-35(38)39-4)37(26-34(32)40-28-37)29-18-10-7-11-19-29/h5,7-16,18-23,32-34H,6,17,24-28H2,1-4H3/b16-5-/t32-,33-,34-,37-/m1/s1 |
| InChIKey | UZNRVBUSNMRSLT-YNMKHFJGSA-N |
| XLogP | 6.83 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.86 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|