C28H33FO4 — CID 57021244
7-[(1S,4R,5S,6R)-4-(4-fluorophenyl)-6-[(3-methylphenyl)methoxymethyl]-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoic acid (PubChem CID 57021244) has the molecular formula C28H33FO4 and a molecular weight of 452.57 g/mol. Its IUPAC name is 7-[(1S,4R,5S,6R)-4-(4-fluorophenyl)-6-[(3-methylphenyl)methoxymethyl]-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoic acid.
| Compound Name | 7-[(1S,4R,5S,6R)-4-(4-fluorophenyl)-6-[(3-methylphenyl)methoxymethyl]-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 57021244 |
| Molecular Formula | C28H33FO4 |
| Molecular Weight | 452.57 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | 7-[(1S,4R,5S,6R)-4-(4-fluorophenyl)-6-[(3-methylphenyl)methoxymethyl]-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoic acid |
| SMILES | Cc1cccc(COC[C@@H]2[C@@H]3C[C@@](c4ccc(F)cc4)(CO3)[C@H]2CC=CCCCC(=O)O)c1 |
| InChI | InChI=1S/C28H33FO4/c1-20-7-6-8-21(15-20)17-32-18-24-25(9-4-2-3-5-10-27(30)31)28(16-26(24)33-19-28)22-11-13-23(29)14-12-22/h2,4,6-8,11-15,24-26H,3,5,9-10,16-19H2,1H3,(H,30,31)/t24-,25-,26-,28-/m0/s1 |
| InChIKey | IHMZLEXYDYFNNG-OBXRUURASA-N |
| XLogP | 5.82 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.57 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|