C31H32FNO5S — CID 67857644
(Z)-7-[(1S,4R,5R,6S)-6-[(4-fluorophenyl)sulfonylamino]-4-(4-phenylphenyl)-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoic acid (PubChem CID 67857644) has the molecular formula C31H32FNO5S and a molecular weight of 549.66 g/mol. Its IUPAC name is (Z)-7-[(1S,4R,5R,6S)-6-[(4-fluorophenyl)sulfonylamino]-4-(4-phenylphenyl)-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1S,4R,5R,6S)-6-[(4-fluorophenyl)sulfonylamino]-4-(4-phenylphenyl)-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 67857644 |
| Molecular Formula | C31H32FNO5S |
| Molecular Weight | 549.66 g/mol |
| Exact Mass | 549.20 |
| IUPAC Name | (Z)-7-[(1S,4R,5R,6S)-6-[(4-fluorophenyl)sulfonylamino]-4-(4-phenylphenyl)-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@H]1[C@H](NS(=O)(=O)c2ccc(F)cc2)[C@@H]2C[C@@]1(c1ccc(-c3ccccc3)cc1)CO2 |
| InChI | InChI=1S/C31H32FNO5S/c32-25-16-18-26(19-17-25)39(36,37)33-30-27(10-6-1-2-7-11-29(34)35)31(20-28(30)38-21-31)24-14-12-23(13-15-24)22-8-4-3-5-9-22/h1,3-6,8-9,12-19,27-28,30,33H,2,7,10-11,20-21H2,(H,34,35)/b6-1-/t27-,28-,30-,31-/m0/s1 |
| InChIKey | IIKIPLPNSKHJHG-DVESICPWSA-N |
| XLogP | 5.70 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.66 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|