C37H42O4 — CID 67857529
methyl (Z)-7-[(1S,4R,5S,6S)-6-[(E,3R)-3-hydroxy-4-phenylpent-1-enyl]-4-(4-phenylphenyl)-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoate (PubChem CID 67857529) has the molecular formula C37H42O4 and a molecular weight of 550.74 g/mol. Its IUPAC name is methyl (Z)-7-[(1S,4R,5S,6S)-6-[(E,3R)-3-hydroxy-4-phenylpent-1-enyl]-4-(4-phenylphenyl)-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1S,4R,5S,6S)-6-[(E,3R)-3-hydroxy-4-phenylpent-1-enyl]-4-(4-phenylphenyl)-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoate |
|---|---|
| PubChem CID | 67857529 |
| Molecular Formula | C37H42O4 |
| Molecular Weight | 550.74 g/mol |
| Exact Mass | 550.31 |
| IUPAC Name | methyl (Z)-7-[(1S,4R,5S,6S)-6-[(E,3R)-3-hydroxy-4-phenylpent-1-enyl]-4-(4-phenylphenyl)-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoate |
| SMILES | COC(=O)CCC/C=C\C[C@H]1[C@H](/C=C/[C@@H](O)C(C)c2ccccc2)[C@@H]2C[C@@]1(c1ccc(-c3ccccc3)cc1)CO2 |
| InChI | InChI=1S/C37H42O4/c1-27(28-13-7-5-8-14-28)34(38)24-23-32-33(17-11-3-4-12-18-36(39)40-2)37(25-35(32)41-26-37)31-21-19-30(20-22-31)29-15-9-6-10-16-29/h3,5-11,13-16,19-24,27,32-35,38H,4,12,17-18,25-26H2,1-2H3/b11-3-,24-23+/t27?,32-,33-,34+,35-,37-/m0/s1 |
| InChIKey | YXLVCWFPVBNUPV-JSYSNSKMSA-N |
| XLogP | 7.64 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.74 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|