C21H25FO3 — CID 67857295
(Z)-7-[(1S,4R,5S,6S)-6-ethenyl-4-(4-fluorophenyl)-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoic acid (PubChem CID 67857295) has the molecular formula C21H25FO3 and a molecular weight of 344.43 g/mol. Its IUPAC name is (Z)-7-[(1S,4R,5S,6S)-6-ethenyl-4-(4-fluorophenyl)-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1S,4R,5S,6S)-6-ethenyl-4-(4-fluorophenyl)-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 67857295 |
| Molecular Formula | C21H25FO3 |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | (Z)-7-[(1S,4R,5S,6S)-6-ethenyl-4-(4-fluorophenyl)-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoic acid |
| SMILES | C=C[C@@H]1[C@@H]2C[C@@](c3ccc(F)cc3)(CO2)[C@H]1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C21H25FO3/c1-2-17-18(7-5-3-4-6-8-20(23)24)21(13-19(17)25-14-21)15-9-11-16(22)12-10-15/h2-3,5,9-12,17-19H,1,4,6-8,13-14H2,(H,23,24)/b5-3-/t17-,18-,19-,21-/m0/s1 |
| InChIKey | DGNGQLAYUCBFSD-POWPUZRCSA-N |
| XLogP | 4.49 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|