C33H35FO4 — CID 57222868
7-[(1S,4R,5S,6R)-4-(4-fluorophenyl)-6-[(4-phenylphenyl)methoxymethyl]-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoic acid (PubChem CID 57222868) has the molecular formula C33H35FO4 and a molecular weight of 514.64 g/mol. Its IUPAC name is 7-[(1S,4R,5S,6R)-4-(4-fluorophenyl)-6-[(4-phenylphenyl)methoxymethyl]-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoic acid.
| Compound Name | 7-[(1S,4R,5S,6R)-4-(4-fluorophenyl)-6-[(4-phenylphenyl)methoxymethyl]-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 57222868 |
| Molecular Formula | C33H35FO4 |
| Molecular Weight | 514.64 g/mol |
| Exact Mass | 514.25 |
| IUPAC Name | 7-[(1S,4R,5S,6R)-4-(4-fluorophenyl)-6-[(4-phenylphenyl)methoxymethyl]-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoic acid |
| SMILES | O=C(O)CCCC=CC[C@H]1[C@H](COCc2ccc(-c3ccccc3)cc2)[C@@H]2C[C@@]1(c1ccc(F)cc1)CO2 |
| InChI | InChI=1S/C33H35FO4/c34-28-18-16-27(17-19-28)33-20-31(38-23-33)29(30(33)10-6-1-2-7-11-32(35)36)22-37-21-24-12-14-26(15-13-24)25-8-4-3-5-9-25/h1,3-6,8-9,12-19,29-31H,2,7,10-11,20-23H2,(H,35,36)/t29-,30-,31-,33-/m0/s1 |
| InChIKey | JUPGWLILXJIMHT-QUUJSONZSA-N |
| XLogP | 7.18 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.64 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|