C30H31NO4 — CID 67857360
(Z)-7-[(1S,5S,6R)-6-[(4-cyanophenyl)methoxymethyl]-4-(2-phenylethynyl)-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoic acid (PubChem CID 67857360) has the molecular formula C30H31NO4 and a molecular weight of 469.58 g/mol. Its IUPAC name is (Z)-7-[(1S,5S,6R)-6-[(4-cyanophenyl)methoxymethyl]-4-(2-phenylethynyl)-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1S,5S,6R)-6-[(4-cyanophenyl)methoxymethyl]-4-(2-phenylethynyl)-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 67857360 |
| Molecular Formula | C30H31NO4 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | (Z)-7-[(1S,5S,6R)-6-[(4-cyanophenyl)methoxymethyl]-4-(2-phenylethynyl)-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoic acid |
| SMILES | N#Cc1ccc(COC[C@@H]2[C@@H]3CC(C#Cc4ccccc4)(CO3)[C@H]2C/C=C\CCCC(=O)O)cc1 |
| InChI | InChI=1S/C30H31NO4/c31-19-24-12-14-25(15-13-24)20-34-21-26-27(10-6-1-2-7-11-29(32)33)30(18-28(26)35-22-30)17-16-23-8-4-3-5-9-23/h1,3-6,8-9,12-15,26-28H,2,7,10-11,18,20-22H2,(H,32,33)/b6-1-/t26-,27-,28-,30?/m0/s1 |
| InChIKey | RGUIKRLUUZCLJT-NYDRAJOOSA-N |
| XLogP | 5.35 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|