C26H28F2O5 — CID 67857358
2-[(Z)-4-[4-(4-fluorophenyl)-6-[(4-fluorophenyl)methoxymethyl]-2-oxabicyclo[2.2.1]heptan-5-yl]but-2-enoxy]acetic acid (PubChem CID 67857358) has the molecular formula C26H28F2O5 and a molecular weight of 458.50 g/mol. Its IUPAC name is 2-[(Z)-4-[4-(4-fluorophenyl)-6-[(4-fluorophenyl)methoxymethyl]-2-oxabicyclo[2.2.1]heptan-5-yl]but-2-enoxy]acetic acid.
| Compound Name | 2-[(Z)-4-[4-(4-fluorophenyl)-6-[(4-fluorophenyl)methoxymethyl]-2-oxabicyclo[2.2.1]heptan-5-yl]but-2-enoxy]acetic acid |
|---|---|
| PubChem CID | 67857358 |
| Molecular Formula | C26H28F2O5 |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | 2-[(Z)-4-[4-(4-fluorophenyl)-6-[(4-fluorophenyl)methoxymethyl]-2-oxabicyclo[2.2.1]heptan-5-yl]but-2-enoxy]acetic acid |
| SMILES | O=C(O)COC/C=C\CC1C(COCc2ccc(F)cc2)C2CC1(c1ccc(F)cc1)CO2 |
| InChI | InChI=1S/C26H28F2O5/c27-20-8-4-18(5-9-20)14-32-15-22-23(3-1-2-12-31-16-25(29)30)26(13-24(22)33-17-26)19-6-10-21(28)11-7-19/h1-2,4-11,22-24H,3,12-17H2,(H,29,30)/b2-1- |
| InChIKey | MZPHMRNKRXCUPF-UPHRSURJSA-N |
| XLogP | 4.50 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|