C30H35F3O4 — CID 57007973
7-[(1R,4S,5R,6S)-4-(2-phenylethyl)-6-[[3-(trifluoromethyl)phenyl]methoxymethyl]-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoic acid (PubChem CID 57007973) has the molecular formula C30H35F3O4 and a molecular weight of 516.60 g/mol. Its IUPAC name is 7-[(1R,4S,5R,6S)-4-(2-phenylethyl)-6-[[3-(trifluoromethyl)phenyl]methoxymethyl]-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoic acid.
| Compound Name | 7-[(1R,4S,5R,6S)-4-(2-phenylethyl)-6-[[3-(trifluoromethyl)phenyl]methoxymethyl]-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 57007973 |
| Molecular Formula | C30H35F3O4 |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.25 |
| IUPAC Name | 7-[(1R,4S,5R,6S)-4-(2-phenylethyl)-6-[[3-(trifluoromethyl)phenyl]methoxymethyl]-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoic acid |
| SMILES | O=C(O)CCCC=CC[C@@H]1[C@@H](COCc2cccc(C(F)(F)F)c2)[C@H]2C[C@]1(CCc1ccccc1)CO2 |
| InChI | InChI=1S/C30H35F3O4/c31-30(32,33)24-12-8-11-23(17-24)19-36-20-25-26(13-6-1-2-7-14-28(34)35)29(18-27(25)37-21-29)16-15-22-9-4-3-5-10-22/h1,3-6,8-12,17,25-27H,2,7,13-16,18-21H2,(H,34,35)/t25-,26-,27-,29-/m1/s1 |
| InChIKey | YDFWJYIOCCKAKY-LTGLEFCMSA-N |
| XLogP | 7.08 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|