C20H28O4 — CID 70399996
(Z)-7-[(3R,4S)-4-(2-phenylethoxymethyl)oxolan-3-yl]hept-5-enoic acid (PubChem CID 70399996) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is (Z)-7-[(3R,4S)-4-(2-phenylethoxymethyl)oxolan-3-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(3R,4S)-4-(2-phenylethoxymethyl)oxolan-3-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70399996 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (Z)-7-[(3R,4S)-4-(2-phenylethoxymethyl)oxolan-3-yl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@H]1COC[C@@H]1COCCc1ccccc1 |
| InChI | InChI=1S/C20H28O4/c21-20(22)11-7-2-1-6-10-18-14-24-16-19(18)15-23-13-12-17-8-4-3-5-9-17/h1,3-6,8-9,18-19H,2,7,10-16H2,(H,21,22)/b6-1-/t18-,19-/m0/s1 |
| InChIKey | MZENTTBVKNAHSK-VAAVRZMISA-N |
| XLogP | 3.71 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|