C27H30F2O6 — CID 67857732
2-[(E)-4-[6-[2-(4-fluorophenoxy)ethoxymethyl]-4-(4-fluorophenyl)-2-oxabicyclo[2.2.1]heptan-5-yl]but-2-enoxy]acetic acid (PubChem CID 67857732) has the molecular formula C27H30F2O6 and a molecular weight of 488.53 g/mol. Its IUPAC name is 2-[(E)-4-[6-[2-(4-fluorophenoxy)ethoxymethyl]-4-(4-fluorophenyl)-2-oxabicyclo[2.2.1]heptan-5-yl]but-2-enoxy]acetic acid.
| Compound Name | 2-[(E)-4-[6-[2-(4-fluorophenoxy)ethoxymethyl]-4-(4-fluorophenyl)-2-oxabicyclo[2.2.1]heptan-5-yl]but-2-enoxy]acetic acid |
|---|---|
| PubChem CID | 67857732 |
| Molecular Formula | C27H30F2O6 |
| Molecular Weight | 488.53 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | 2-[(E)-4-[6-[2-(4-fluorophenoxy)ethoxymethyl]-4-(4-fluorophenyl)-2-oxabicyclo[2.2.1]heptan-5-yl]but-2-enoxy]acetic acid |
| SMILES | O=C(O)COC/C=C/CC1C(COCCOc2ccc(F)cc2)C2CC1(c1ccc(F)cc1)CO2 |
| InChI | InChI=1S/C27H30F2O6/c28-20-6-4-19(5-7-20)27-15-25(35-18-27)23(24(27)3-1-2-12-32-17-26(30)31)16-33-13-14-34-22-10-8-21(29)9-11-22/h1-2,4-11,23-25H,3,12-18H2,(H,30,31)/b2-1+ |
| InChIKey | SOVPQXRXDYJSRR-OWOJBTEDSA-N |
| XLogP | 4.38 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.53 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|