C26H35FO5 — CID 67857327
2-[(E)-4-[(1S,4R,5S,6S)-4-(4-fluorophenyl)-6-[(E,3R)-3-hydroxyoct-1-enyl]-2-oxabicyclo[2.2.1]heptan-5-yl]but-2-enoxy]acetic acid (PubChem CID 67857327) has the molecular formula C26H35FO5 and a molecular weight of 446.56 g/mol. Its IUPAC name is 2-[(E)-4-[(1S,4R,5S,6S)-4-(4-fluorophenyl)-6-[(E,3R)-3-hydroxyoct-1-enyl]-2-oxabicyclo[2.2.1]heptan-5-yl]but-2-enoxy]acetic acid.
| Compound Name | 2-[(E)-4-[(1S,4R,5S,6S)-4-(4-fluorophenyl)-6-[(E,3R)-3-hydroxyoct-1-enyl]-2-oxabicyclo[2.2.1]heptan-5-yl]but-2-enoxy]acetic acid |
|---|---|
| PubChem CID | 67857327 |
| Molecular Formula | C26H35FO5 |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | 2-[(E)-4-[(1S,4R,5S,6S)-4-(4-fluorophenyl)-6-[(E,3R)-3-hydroxyoct-1-enyl]-2-oxabicyclo[2.2.1]heptan-5-yl]but-2-enoxy]acetic acid |
| SMILES | CCCCC[C@@H](O)/C=C/[C@@H]1[C@@H]2C[C@@](c3ccc(F)cc3)(CO2)[C@H]1C/C=C/COCC(=O)O |
| InChI | InChI=1S/C26H35FO5/c1-2-3-4-7-21(28)13-14-22-23(8-5-6-15-31-17-25(29)30)26(16-24(22)32-18-26)19-9-11-20(27)12-10-19/h5-6,9-14,21-24,28H,2-4,7-8,15-18H2,1H3,(H,29,30)/b6-5+,14-13+/t21-,22+,23+,24+,26+/m1/s1 |
| InChIKey | BKANFIKXSUOBOZ-KAVWMTRISA-N |
| XLogP | 4.64 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|