C22H38O2 — CID 70370709
1-(5-hept-2-enyl-4-methyl-2-oxabicyclo[2.2.1]heptan-6-yl)oct-1-en-3-ol (PubChem CID 70370709) has the molecular formula C22H38O2 and a molecular weight of 334.54 g/mol. Its IUPAC name is 1-(5-hept-2-enyl-4-methyl-2-oxabicyclo[2.2.1]heptan-6-yl)oct-1-en-3-ol.
| Compound Name | 1-(5-hept-2-enyl-4-methyl-2-oxabicyclo[2.2.1]heptan-6-yl)oct-1-en-3-ol |
|---|---|
| PubChem CID | 70370709 |
| Molecular Formula | C22H38O2 |
| Molecular Weight | 334.54 g/mol |
| Exact Mass | 334.29 |
| IUPAC Name | 1-(5-hept-2-enyl-4-methyl-2-oxabicyclo[2.2.1]heptan-6-yl)oct-1-en-3-ol |
| SMILES | CCCCC=CCC1C(C=CC(O)CCCCC)C2CC1(C)CO2 |
| InChI | InChI=1S/C22H38O2/c1-4-6-8-9-11-13-20-19(21-16-22(20,3)17-24-21)15-14-18(23)12-10-7-5-2/h9,11,14-15,18-21,23H,4-8,10,12-13,16-17H2,1-3H3 |
| InChIKey | DBKOPMAPIZKOSI-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.54 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|