C34H44O4 — CID 70354289
methyl (Z)-7-[(1S,4R,5S,6S)-6-[(E,3S)-3-hydroxyoct-1-enyl]-4-(4-phenylphenyl)-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoate (PubChem CID 70354289) has the molecular formula C34H44O4 and a molecular weight of 516.72 g/mol. Its IUPAC name is methyl (Z)-7-[(1S,4R,5S,6S)-6-[(E,3S)-3-hydroxyoct-1-enyl]-4-(4-phenylphenyl)-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1S,4R,5S,6S)-6-[(E,3S)-3-hydroxyoct-1-enyl]-4-(4-phenylphenyl)-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoate |
|---|---|
| PubChem CID | 70354289 |
| Molecular Formula | C34H44O4 |
| Molecular Weight | 516.72 g/mol |
| Exact Mass | 516.32 |
| IUPAC Name | methyl (Z)-7-[(1S,4R,5S,6S)-6-[(E,3S)-3-hydroxyoct-1-enyl]-4-(4-phenylphenyl)-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoate |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1[C@@H]2C[C@@](c3ccc(-c4ccccc4)cc3)(CO2)[C@H]1C/C=C\CCCC(=O)OC |
| InChI | InChI=1S/C34H44O4/c1-3-4-8-15-29(35)22-23-30-31(16-11-5-6-12-17-33(36)37-2)34(24-32(30)38-25-34)28-20-18-27(19-21-28)26-13-9-7-10-14-26/h5,7,9-11,13-14,18-23,29-32,35H,3-4,6,8,12,15-17,24-25H2,1-2H3/b11-5-,23-22+/t29-,30-,31-,32-,34-/m0/s1 |
| InChIKey | VGAIAMSCHWWTNB-ZBGBJNLOSA-N |
| XLogP | 7.41 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.72 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|