C29H36ClFO4 — CID 57216078
methyl 7-[(1S,4R,5S,6S)-6-(7-chloro-4-methyl-3-oxoocta-1,6-dienyl)-4-(4-fluorophenyl)-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoate (PubChem CID 57216078) has the molecular formula C29H36ClFO4 and a molecular weight of 503.05 g/mol. Its IUPAC name is methyl 7-[(1S,4R,5S,6S)-6-(7-chloro-4-methyl-3-oxoocta-1,6-dienyl)-4-(4-fluorophenyl)-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoate.
| Compound Name | methyl 7-[(1S,4R,5S,6S)-6-(7-chloro-4-methyl-3-oxoocta-1,6-dienyl)-4-(4-fluorophenyl)-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoate |
|---|---|
| PubChem CID | 57216078 |
| Molecular Formula | C29H36ClFO4 |
| Molecular Weight | 503.05 g/mol |
| Exact Mass | 502.23 |
| IUPAC Name | methyl 7-[(1S,4R,5S,6S)-6-(7-chloro-4-methyl-3-oxoocta-1,6-dienyl)-4-(4-fluorophenyl)-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoate |
| SMILES | COC(=O)CCCC=CC[C@H]1[C@H](C=CC(=O)C(C)CC=C(C)Cl)[C@@H]2C[C@@]1(c1ccc(F)cc1)CO2 |
| InChI | InChI=1S/C29H36ClFO4/c1-20(10-11-21(2)30)26(32)17-16-24-25(8-6-4-5-7-9-28(33)34-3)29(18-27(24)35-19-29)22-12-14-23(31)15-13-22/h4,6,11-17,20,24-25,27H,5,7-10,18-19H2,1-3H3/t20?,24-,25-,27-,29-/m0/s1 |
| InChIKey | ZALZMPZYXJXIQH-UBQYSNRCSA-N |
| XLogP | 6.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.05 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|